![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Treaty at Doona/ | 2024-05-08 06:42 | - | |
| To Ride Pegasus/ | 2024-05-08 06:42 | - | |
| The White Dragon/ | 2024-05-08 06:42 | - | |
| The Unicorn Girl/ | 2024-05-08 06:42 | - | |
| The Tower and the Hive/ | 2024-05-08 06:42 | - | |
| The Skies Of Pern/ | 2024-05-08 06:42 | - | |
| The Ship Who Won/ | 2024-05-08 06:42 | - | |
| The Ship Who Searched/ | 2024-05-08 06:42 | - | |
| The Ship Who Sang/ | 2024-05-08 06:42 | - | |
| The Rowan/ | 2024-05-08 06:42 | - | |
| The Renegades of Pern/ | 2024-05-08 06:42 | - | |
| The Masterharper of Pern/ | 2024-05-08 06:42 | - | |
| The Dragonriders of Pern/ | 2024-05-08 06:42 | - | |
| The Death of Sleep/ | 2024-05-08 06:42 | - | |
| The City Who Fought/ | 2024-05-08 06:42 | - | |
| The Chronicles of Pern- First Fall/ | 2024-05-08 06:42 | - | |
| Second Wave/ | 2024-05-08 06:42 | - | |
| Sassinak/ | 2024-05-08 06:42 | - | |
| Restoree/ | 2024-05-08 06:42 | - | |
| Powers That Be/ | 2024-05-08 06:42 | - | |
| Power Play/ | 2024-05-08 06:42 | - | |
| Power Lines/ | 2024-05-08 06:42 | - | |
| Pegasus in Space/ | 2024-05-08 06:42 | - | |
| Pegasus in Flight/ | 2024-05-08 06:42 | - | |
| PartnerShip/ | 2024-05-08 06:42 | - | |
| Nimisha's Ship/ | 2024-05-08 06:42 | - | |
| Nerilka's Story/ | 2024-05-08 06:42 | - | |
| Moreta- Dragonlady of Pern/ | 2024-05-08 06:42 | - | |
| Maelstrom/ | 2024-05-08 06:42 | - | |
| Lyon's Pride/ | 2024-05-08 06:42 | - | |
| Killashandra/ | 2024-05-08 06:42 | - | |
| Get Off the Unicorn/ | 2024-05-08 06:42 | - | |
| Generation Warriors/ | 2024-05-08 06:42 | - | |
| Freedom's Landing/ | 2024-05-08 06:42 | - | |
| Freedom's Choice/ | 2024-05-08 06:42 | - | |
| Freedom's Challenge/ | 2024-05-08 06:42 | - | |
| federations/ | 2024-05-08 06:42 | - | |
| Dragonsinger/ | 2024-05-08 06:42 | - | |
| Dragonseye/ | 2024-05-08 06:42 | - | |
| Dragonsdawn/ | 2024-05-08 06:42 | - | |
| Dragonquest/ | 2024-05-08 06:42 | - | |
| Dragonflight/ | 2024-05-08 06:42 | - | |
| Dragon's Time- Dragonriders of Pern/ | 2024-05-08 06:42 | - | |
| Dragon's Kin/ | 2024-05-08 06:42 | - | |
| Dragon's Fire/ | 2024-05-08 06:42 | - | |
| Dragon Harper/ | 2024-05-08 06:42 | - | |
| Dinosaur Planet Survivors/ | 2024-05-08 06:42 | - | |
| Deluge/ | 2024-05-08 06:42 | - | |
| Decision at Doona/ | 2024-05-08 06:42 | - | |
| Damia's Children/ | 2024-05-08 06:42 | - | |
| Damia/ | 2024-05-08 06:42 | - | |
| Crystal Singer/ | 2024-05-08 06:42 | - | |
| Crystal Line/ | 2024-05-08 06:42 | - | |
| Crisis on Doona/ | 2024-05-08 06:42 | - | |
| Changelings/ | 2024-05-08 06:42 | - | |
| Catalyst/ | 2024-05-08 06:42 | - | |
| Catacombs/ | 2024-05-08 06:42 | - | |
| All the Weyrs of Pern/ | 2024-05-08 06:42 | - | |
| Acorna's World/ | 2024-05-08 06:42 | - | |
| Acorna's Triumph/ | 2024-05-08 06:42 | - | |
| Acorna's Search/ | 2024-05-08 06:42 | - | |
| Acorna's Rebels/ | 2024-05-08 06:42 | - | |
| Acorna's Quest/ | 2024-05-08 06:42 | - | |
| Acorna's People/ | 2024-05-08 06:42 | - | |
| A Gift of Dragons- Illustrated Stories/ | 2024-05-08 06:42 | - | |